C7H9NO — CID 147075759
1-(3,4-dihydropyridin-2-yl)ethanone (PubChem CID 147075759) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-2-yl)ethanone.
| Compound Name | 1-(3,4-dihydropyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 147075759 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1-(3,4-dihydropyridin-2-yl)ethanone |
| SMILES | CC(=O)C1=NC=CCC1 |
| InChI | InChI=1S/C7H9NO/c1-6(9)7-4-2-3-5-8-7/h3,5H,2,4H2,1H3 |
| InChIKey | BFXSYTIKQHYLJH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |