C16H27NO3S — CID 147079130
3-(cyclohexylmethyl)-4a,8a-dimethyl-5,6,7,8-tetrahydro-4,1λ6,2-benzoxathiazine 1,1-dioxide (PubChem CID 147079130) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-4a,8a-dimethyl-5,6,7,8-tetrahydro-4,1λ6,2-benzoxathiazine 1,1-dioxide.
| Compound Name | 3-(cyclohexylmethyl)-4a,8a-dimethyl-5,6,7,8-tetrahydro-4,1λ6,2-benzoxathiazine 1,1-dioxide |
|---|---|
| PubChem CID | 147079130 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-(cyclohexylmethyl)-4a,8a-dimethyl-5,6,7,8-tetrahydro-4,1λ6,2-benzoxathiazine 1,1-dioxide |
| SMILES | CC12CCCCC1(C)S(=O)(=O)N=C(CC1CCCCC1)O2 |
| InChI | InChI=1S/C16H27NO3S/c1-15-10-6-7-11-16(15,2)21(18,19)17-14(20-15)12-13-8-4-3-5-9-13/h13H,3-12H2,1-2H3 |
| InChIKey | BGOFDLKRXKINPB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |