C24H31ClN6O — CID 147080526
9-(4-aminocyclohexyl)-N-(3-chlorophenyl)-2-[(4-methyloxan-4-yl)methyl]purin-8-amine (PubChem CID 147080526) has the molecular formula C24H31ClN6O and a molecular weight of 455.01 g/mol. Its IUPAC name is 9-(4-aminocyclohexyl)-N-(3-chlorophenyl)-2-[(4-methyloxan-4-yl)methyl]purin-8-amine.
| Compound Name | 9-(4-aminocyclohexyl)-N-(3-chlorophenyl)-2-[(4-methyloxan-4-yl)methyl]purin-8-amine |
|---|---|
| PubChem CID | 147080526 |
| Molecular Formula | C24H31ClN6O |
| Molecular Weight | 455.01 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 9-(4-aminocyclohexyl)-N-(3-chlorophenyl)-2-[(4-methyloxan-4-yl)methyl]purin-8-amine |
| SMILES | CC1(Cc2ncc3nc(Nc4cccc(Cl)c4)n(C4CCC(N)CC4)c3n2)CCOCC1 |
| InChI | InChI=1S/C24H31ClN6O/c1-24(9-11-32-12-10-24)14-21-27-15-20-22(30-21)31(19-7-5-17(26)6-8-19)23(29-20)28-18-4-2-3-16(25)13-18/h2-4,13,15,17,19H,5-12,14,26H2,1H3,(H,28,29) |
| InChIKey | BGUZAHAVPODJFO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.01 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |