C15H8Cl2N2 — CID 14710954
2-[cyano-(3,4-dichlorophenyl)methyl]benzonitrile (PubChem CID 14710954) has the molecular formula C15H8Cl2N2 and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-[cyano-(3,4-dichlorophenyl)methyl]benzonitrile.
| Compound Name | 2-[cyano-(3,4-dichlorophenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 14710954 |
| Molecular Formula | C15H8Cl2N2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[cyano-(3,4-dichlorophenyl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl2N2/c16-14-6-5-10(7-15(14)17)13(9-19)12-4-2-1-3-11(12)8-18/h1-7,13H |
| InChIKey | GIONNYIOYPYEPI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |