C18H28N2O2 — CID 14711457
2-[(E)-2-[4-[(E)-2-[2-(dimethylamino)ethoxy]ethenyl]phenyl]ethenoxy]-N,N-dimethylethanamine (PubChem CID 14711457) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(E)-2-[4-[(E)-2-[2-(dimethylamino)ethoxy]ethenyl]phenyl]ethenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(E)-2-[4-[(E)-2-[2-(dimethylamino)ethoxy]ethenyl]phenyl]ethenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 14711457 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[(E)-2-[4-[(E)-2-[2-(dimethylamino)ethoxy]ethenyl]phenyl]ethenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCO/C=C/c1ccc(/C=C/OCCN(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-19(2)11-15-21-13-9-17-5-7-18(8-6-17)10-14-22-16-12-20(3)4/h5-10,13-14H,11-12,15-16H2,1-4H3/b13-9+,14-10+ |
| InChIKey | HODQRDVPGYOQLC-UTLPMFLDSA-N |
| XLogP | 2.78 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|