C20H16ClF3N4O2 — CID 147121475
N-[[1-[(6-chloro-3-pyridinyl)methyl]-2-pyridinylidene]amino]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 147121475) has the molecular formula C20H16ClF3N4O2 and a molecular weight of 436.82 g/mol. Its IUPAC name is N-[[1-[(6-chloro-3-pyridinyl)methyl]-2-pyridinylidene]amino]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[[1-[(6-chloro-3-pyridinyl)methyl]-2-pyridinylidene]amino]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 147121475 |
| Molecular Formula | C20H16ClF3N4O2 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[[1-[(6-chloro-3-pyridinyl)methyl]-2-pyridinylidene]amino]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NN=c1ccccn1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H16ClF3N4O2/c21-17-9-6-15(12-25-17)13-28-10-2-1-3-18(28)26-27-19(29)11-14-4-7-16(8-5-14)30-20(22,23)24/h1-10,12H,11,13H2,(H,27,29) |
| InChIKey | BOLFAYSBNFHAJF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|