C23H20O3S — CID 1471338
(2S)-2-(4-methoxyphenyl)sulfanyl-1,4-diphenylbutane-1,4-dione (PubChem CID 1471338) has the molecular formula C23H20O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)sulfanyl-1,4-diphenylbutane-1,4-dione.
| Compound Name | (2S)-2-(4-methoxyphenyl)sulfanyl-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 1471338 |
| Molecular Formula | C23H20O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)sulfanyl-1,4-diphenylbutane-1,4-dione |
| SMILES | COc1ccc(S[C@@H](CC(=O)c2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20O3S/c1-26-19-12-14-20(15-13-19)27-22(23(25)18-10-6-3-7-11-18)16-21(24)17-8-4-2-5-9-17/h2-15,22H,16H2,1H3/t22-/m0/s1 |
| InChIKey | PGERDLAADWXOMB-QFIPXVFZSA-N |
| XLogP | 5.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |