C12H5IN2S2 — CID 147143795
5-(1,3-benzothiazol-2-yl)-2-iodothiophene-3-carbonitrile (PubChem CID 147143795) has the molecular formula C12H5IN2S2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-2-iodothiophene-3-carbonitrile.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-2-iodothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 147143795 |
| Molecular Formula | C12H5IN2S2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.89 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-2-iodothiophene-3-carbonitrile |
| SMILES | N#Cc1cc(-c2nc3ccccc3s2)sc1I |
| InChI | InChI=1S/C12H5IN2S2/c13-11-7(6-14)5-10(16-11)12-15-8-3-1-2-4-9(8)17-12/h1-5H |
| InChIKey | BSQGHCSJCWMAMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|