C13H23N3OS2 — CID 147145649
6-decoxy-1H-1,3,5-triazine-2,4-dithione (PubChem CID 147145649) has the molecular formula C13H23N3OS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is 6-decoxy-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-decoxy-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 147145649 |
| Molecular Formula | C13H23N3OS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-decoxy-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCCCCCCCOc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C13H23N3OS2/c1-2-3-4-5-6-7-8-9-10-17-11-14-12(18)16-13(19)15-11/h2-10H2,1H3,(H2,14,15,16,18,19) |
| InChIKey | BSZNUIIRIMVTPB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|