C9H12LiNO2S — CID 14715704
lithium N,N-dimethyl-1-phenylmethanesulfonamide (PubChem CID 14715704) has the molecular formula C9H12LiNO2S and a molecular weight of 205.21 g/mol. Its IUPAC name is lithium N,N-dimethyl-1-phenylmethanesulfonamide.
| Compound Name | lithium N,N-dimethyl-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 14715704 |
| Molecular Formula | C9H12LiNO2S |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | lithium N,N-dimethyl-1-phenylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)[CH-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C9H12NO2S.Li/c1-10(2)13(11,12)8-9-6-4-3-5-7-9;/h3-8H,1-2H3;/q-1;+1 |
| InChIKey | VQBWCKZDIJVHOS-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|