C11H16LiNO2S — CID 177489558
lithium 3-(benzenesulfonyl)-N,N-dimethylpropan-1-amine (PubChem CID 177489558) has the molecular formula C11H16LiNO2S and a molecular weight of 233.26 g/mol. Its IUPAC name is lithium 3-(benzenesulfonyl)-N,N-dimethylpropan-1-amine.
| Compound Name | lithium 3-(benzenesulfonyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 177489558 |
| Molecular Formula | C11H16LiNO2S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | lithium 3-(benzenesulfonyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC[CH-]S(=O)(=O)c1ccccc1.[Li+] |
| InChI | InChI=1S/C11H16NO2S.Li/c1-12(2)9-6-10-15(13,14)11-7-4-3-5-8-11;/h3-5,7-8,10H,6,9H2,1-2H3;/q-1;+1 |
| InChIKey | AGHOTFHCGXYQJY-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|