C17H10F2N2O3 — CID 14716135
[4-(5-hydroxypyrimidin-2-yl)phenyl] 2,4-difluorobenzoate (PubChem CID 14716135) has the molecular formula C17H10F2N2O3 and a molecular weight of 328.27 g/mol. Its IUPAC name is [4-(5-hydroxypyrimidin-2-yl)phenyl] 2,4-difluorobenzoate.
| Compound Name | [4-(5-hydroxypyrimidin-2-yl)phenyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 14716135 |
| Molecular Formula | C17H10F2N2O3 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [4-(5-hydroxypyrimidin-2-yl)phenyl] 2,4-difluorobenzoate |
| SMILES | O=C(Oc1ccc(-c2ncc(O)cn2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H10F2N2O3/c18-11-3-6-14(15(19)7-11)17(23)24-13-4-1-10(2-5-13)16-20-8-12(22)9-21-16/h1-9,22H |
| InChIKey | XZUATOQZUNAQCY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|