C24H25FN2O2S — CID 147178330
5-[[(E)-ethylidene(methyl)-λ4-sulfanyl]-methylamino]-7-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-6H-cyclopenta[g]quinolin-8-one (PubChem CID 147178330) has the molecular formula C24H25FN2O2S and a molecular weight of 424.54 g/mol. Its IUPAC name is 5-[[(E)-ethylidene(methyl)-λ4-sulfanyl]-methylamino]-7-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-6H-cyclopenta[g]quinolin-8-one.
| Compound Name | 5-[[(E)-ethylidene(methyl)-λ4-sulfanyl]-methylamino]-7-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-6H-cyclopenta[g]quinolin-8-one |
|---|---|
| PubChem CID | 147178330 |
| Molecular Formula | C24H25FN2O2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 5-[[(E)-ethylidene(methyl)-λ4-sulfanyl]-methylamino]-7-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-6H-cyclopenta[g]quinolin-8-one |
| SMILES | C/C=S(\C)N(C)c1c2c(c(O)c3ncccc13)C(=O)C(C)(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C24H25FN2O2S/c1-5-30(4)27(3)21-17-7-6-12-26-20(17)22(28)19-18(21)14-24(2,23(19)29)13-15-8-10-16(25)11-9-15/h5-12,28H,13-14H2,1-4H3 |
| InChIKey | BZBVETZNJHQIOW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|