C21H16BrCl2N — CID 147186204
10-(4-bromophenyl)-3,6-dichloro-9,9-dimethylacridine (PubChem CID 147186204) has the molecular formula C21H16BrCl2N and a molecular weight of 433.18 g/mol. Its IUPAC name is 10-(4-bromophenyl)-3,6-dichloro-9,9-dimethylacridine.
| Compound Name | 10-(4-bromophenyl)-3,6-dichloro-9,9-dimethylacridine |
|---|---|
| PubChem CID | 147186204 |
| Molecular Formula | C21H16BrCl2N |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 10-(4-bromophenyl)-3,6-dichloro-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccc(Cl)cc2N(c2ccc(Br)cc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H16BrCl2N/c1-21(2)17-9-5-14(23)11-19(17)25(16-7-3-13(22)4-8-16)20-12-15(24)6-10-18(20)21/h3-12H,1-2H3 |
| InChIKey | CANQSSGKHLDHNI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |