C24H14Br4N2 — CID 122390702
2,7-dibromo-5,10-bis(4-bromophenyl)phenazine (PubChem CID 122390702) has the molecular formula C24H14Br4N2 and a molecular weight of 650.01 g/mol. Its IUPAC name is 2,7-dibromo-5,10-bis(4-bromophenyl)phenazine.
| Compound Name | 2,7-dibromo-5,10-bis(4-bromophenyl)phenazine |
|---|---|
| PubChem CID | 122390702 |
| Molecular Formula | C24H14Br4N2 |
| Molecular Weight | 650.01 g/mol |
| Exact Mass | 645.79 |
| IUPAC Name | 2,7-dibromo-5,10-bis(4-bromophenyl)phenazine |
| SMILES | Brc1ccc(N2c3ccc(Br)cc3N(c3ccc(Br)cc3)c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C24H14Br4N2/c25-15-1-7-19(8-2-15)29-21-11-5-18(28)14-24(21)30(20-9-3-16(26)4-10-20)22-12-6-17(27)13-23(22)29/h1-14H |
| InChIKey | CULLJOVPNMDHJI-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.01 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |