C10H7N3O3S — CID 147223090
2-[(3-cyano-5-isocyano-4-methyl-6-oxo-1H-pyridin-2-yl)sulfanyl]acetic acid (PubChem CID 147223090) has the molecular formula C10H7N3O3S and a molecular weight of 249.25 g/mol. Its IUPAC name is 2-[(3-cyano-5-isocyano-4-methyl-6-oxo-1H-pyridin-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(3-cyano-5-isocyano-4-methyl-6-oxo-1H-pyridin-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 147223090 |
| Molecular Formula | C10H7N3O3S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-[(3-cyano-5-isocyano-4-methyl-6-oxo-1H-pyridin-2-yl)sulfanyl]acetic acid |
| SMILES | [C-]#[N+]c1c(C)c(C#N)c(SCC(=O)O)[nH]c1=O |
| InChI | InChI=1S/C10H7N3O3S/c1-5-6(3-11)10(17-4-7(14)15)13-9(16)8(5)12-2/h4H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | CHLNOGOYMBFAJT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|