C9H7F4N5OS — CID 162608459
N'-amino-2-[[3-cyano-5-fluoro-6-oxo-4-(trifluoromethyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide (PubChem CID 162608459) has the molecular formula C9H7F4N5OS and a molecular weight of 309.25 g/mol. Its IUPAC name is N'-amino-2-[[3-cyano-5-fluoro-6-oxo-4-(trifluoromethyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide.
| Compound Name | N'-amino-2-[[3-cyano-5-fluoro-6-oxo-4-(trifluoromethyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 162608459 |
| Molecular Formula | C9H7F4N5OS |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N'-amino-2-[[3-cyano-5-fluoro-6-oxo-4-(trifluoromethyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
| SMILES | N#Cc1c(SCC(N)=NN)[nH]c(=O)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C9H7F4N5OS/c10-6-5(9(11,12)13)3(1-14)8(17-7(6)19)20-2-4(15)18-16/h2,16H2,(H2,15,18)(H,17,19) |
| InChIKey | GNCJFQACTCWPOU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|