C22H19N7O2S — CID 176980519
N,N'-diamino-2-[[3,5-dicyano-4-[3-(4-methoxyphenyl)phenyl]-6-oxo-1H-pyridin-2-yl]sulfanyl]ethanimidamide (PubChem CID 176980519) has the molecular formula C22H19N7O2S and a molecular weight of 445.51 g/mol. Its IUPAC name is N,N'-diamino-2-[[3,5-dicyano-4-[3-(4-methoxyphenyl)phenyl]-6-oxo-1H-pyridin-2-yl]sulfanyl]ethanimidamide.
| Compound Name | N,N'-diamino-2-[[3,5-dicyano-4-[3-(4-methoxyphenyl)phenyl]-6-oxo-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 176980519 |
| Molecular Formula | C22H19N7O2S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N,N'-diamino-2-[[3,5-dicyano-4-[3-(4-methoxyphenyl)phenyl]-6-oxo-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
| SMILES | COc1ccc(-c2cccc(-c3c(C#N)c(SCC(=NN)NN)[nH]c(=O)c3C#N)c2)cc1 |
| InChI | InChI=1S/C22H19N7O2S/c1-31-16-7-5-13(6-8-16)14-3-2-4-15(9-14)20-17(10-23)21(30)27-22(18(20)11-24)32-12-19(28-25)29-26/h2-9H,12,25-26H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | DYKOORIDBRNSJO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 166.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|