C20H17ClN6OS — CID 176980408
N,N'-diamino-2-[[5-chloro-3-cyano-6-oxo-4-(3-phenylphenyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide (PubChem CID 176980408) has the molecular formula C20H17ClN6OS and a molecular weight of 424.92 g/mol. Its IUPAC name is N,N'-diamino-2-[[5-chloro-3-cyano-6-oxo-4-(3-phenylphenyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide.
| Compound Name | N,N'-diamino-2-[[5-chloro-3-cyano-6-oxo-4-(3-phenylphenyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 176980408 |
| Molecular Formula | C20H17ClN6OS |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N,N'-diamino-2-[[5-chloro-3-cyano-6-oxo-4-(3-phenylphenyl)-1H-pyridin-2-yl]sulfanyl]ethanimidamide |
| SMILES | N#Cc1c(SC/C(=N/N)NN)[nH]c(=O)c(Cl)c1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H17ClN6OS/c21-18-17(14-8-4-7-13(9-14)12-5-2-1-3-6-12)15(10-22)20(25-19(18)28)29-11-16(26-23)27-24/h1-9H,11,23-24H2,(H,25,28)(H,26,27) |
| InChIKey | OOXLJPGEIJBHOM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|