C11H18O4S — CID 147261937
4-hydroxy-3-methyl-1,2,3,4,5,6,7,8-octahydronaphthalene-1-sulfonic acid (PubChem CID 147261937) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-1,2,3,4,5,6,7,8-octahydronaphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-methyl-1,2,3,4,5,6,7,8-octahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 147261937 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-hydroxy-3-methyl-1,2,3,4,5,6,7,8-octahydronaphthalene-1-sulfonic acid |
| SMILES | CC1CC(S(=O)(=O)O)C2=C(CCCC2)C1O |
| InChI | InChI=1S/C11H18O4S/c1-7-6-10(16(13,14)15)8-4-2-3-5-9(8)11(7)12/h7,10-12H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | COSRSXACWWOXFF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|