C20H27ClN2O5 — CID 147265335
4-[2-[8-chloro-4-ethoxy-2-(2-methoxyethoxy)quinolin-7-yl]oxyethyl]morpholine (PubChem CID 147265335) has the molecular formula C20H27ClN2O5 and a molecular weight of 410.90 g/mol. Its IUPAC name is 4-[2-[8-chloro-4-ethoxy-2-(2-methoxyethoxy)quinolin-7-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[8-chloro-4-ethoxy-2-(2-methoxyethoxy)quinolin-7-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 147265335 |
| Molecular Formula | C20H27ClN2O5 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[2-[8-chloro-4-ethoxy-2-(2-methoxyethoxy)quinolin-7-yl]oxyethyl]morpholine |
| SMILES | CCOc1cc(OCCOC)nc2c(Cl)c(OCCN3CCOCC3)ccc12 |
| InChI | InChI=1S/C20H27ClN2O5/c1-3-26-17-14-18(28-13-12-24-2)22-20-15(17)4-5-16(19(20)21)27-11-8-23-6-9-25-10-7-23/h4-5,14H,3,6-13H2,1-2H3 |
| InChIKey | CPJCTKQBFYVJHY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|