C16H13IN2 — CID 147320861
12-methylimidazo[1,2-f]phenanthridin-1-ium iodide (PubChem CID 147320861) has the molecular formula C16H13IN2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 12-methylimidazo[1,2-f]phenanthridin-1-ium iodide.
| Compound Name | 12-methylimidazo[1,2-f]phenanthridin-1-ium iodide |
|---|---|
| PubChem CID | 147320861 |
| Molecular Formula | C16H13IN2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 12-methylimidazo[1,2-f]phenanthridin-1-ium iodide |
| SMILES | Cc1cccc2c3ccccc3n3cc[nH+]c3c12.[I-] |
| InChI | InChI=1S/C16H12N2.HI/c1-11-5-4-7-13-12-6-2-3-8-14(12)18-10-9-17-16(18)15(11)13;/h2-10H,1H3;1H |
| InChIKey | YYOMWHGDAZNUHD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 18.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|