C29H29I2N3O6 — CID 147345642
2-[[5-iodo-4-(iodoamino)-5-oxopentanoyl]amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4-dihydrobenzo[h]chromen-6-ylidene)amino]benzoate (PubChem CID 147345642) has the molecular formula C29H29I2N3O6 and a molecular weight of 769.37 g/mol. Its IUPAC name is 2-[[5-iodo-4-(iodoamino)-5-oxopentanoyl]amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4-dihydrobenzo[h]chromen-6-ylidene)amino]benzoate.
| Compound Name | 2-[[5-iodo-4-(iodoamino)-5-oxopentanoyl]amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4-dihydrobenzo[h]chromen-6-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 147345642 |
| Molecular Formula | C29H29I2N3O6 |
| Molecular Weight | 769.37 g/mol |
| Exact Mass | 769.01 |
| IUPAC Name | 2-[[5-iodo-4-(iodoamino)-5-oxopentanoyl]amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4-dihydrobenzo[h]chromen-6-ylidene)amino]benzoate |
| SMILES | CC1(C)CCC2=C(O1)c1ccccc1/C(=N/c1ccc(C(=O)OCCNC(=O)CCC(NI)C(=O)I)cc1)C2=O |
| InChI | InChI=1S/C29H29I2N3O6/c1-29(2)14-13-21-25(36)24(19-5-3-4-6-20(19)26(21)40-29)33-18-9-7-17(8-10-18)28(38)39-16-15-32-23(35)12-11-22(34-31)27(30)37/h3-10,22,34H,11-16H2,1-2H3,(H,32,35)/b33-24- |
| InChIKey | DEJMSEZTEMPFJI-GIBOGKFOSA-N |
| XLogP | 5.01 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|