C29H33N3O6 — CID 143187491
2-[(4-amino-5-oxopentanoyl)amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4,10,10a-tetrahydrobenzo[h]chromen-6-ylidene)amino]benzoate (PubChem CID 143187491) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is 2-[(4-amino-5-oxopentanoyl)amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4,10,10a-tetrahydrobenzo[h]chromen-6-ylidene)amino]benzoate.
| Compound Name | 2-[(4-amino-5-oxopentanoyl)amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4,10,10a-tetrahydrobenzo[h]chromen-6-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 143187491 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-[(4-amino-5-oxopentanoyl)amino]ethyl 4-[(2,2-dimethyl-5-oxo-3,4,10,10a-tetrahydrobenzo[h]chromen-6-ylidene)amino]benzoate |
| SMILES | CC1(C)CCC2=C(O1)C1CC=CC=C1/C(=N/c1ccc(C(=O)OCCNC(=O)CCC(N)C=O)cc1)C2=O |
| InChI | InChI=1S/C29H33N3O6/c1-29(2)14-13-23-26(35)25(21-5-3-4-6-22(21)27(23)38-29)32-20-10-7-18(8-11-20)28(36)37-16-15-31-24(34)12-9-19(30)17-33/h3-5,7-8,10-11,17,19,22H,6,9,12-16,30H2,1-2H3,(H,31,34)/b32-25- |
| InChIKey | ZCVCAOUVZLVQAA-MKCFTUBBSA-N |
| XLogP | 3.27 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|