About 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one
1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one (PubChem CID 147353970) has the molecular formula C16H15F3N2O2
and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one.
Molecular Properties
| Compound Name | 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one |
| PubChem CID | 147353970 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)C(=C(O)c1ncnc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2/c1-15(2,3)14(23)11(16(17,18)19)13(22)12-9-6-4-5-7-10(9)20-8-21-12/h4-8,22H,1-3H3 |
| InChIKey | MGUNUMYBYLRRPZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one?
The IUPAC name of 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one (CID 147353970) is 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one.
What is the SMILES notation for 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one?
The canonical SMILES for 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one is CC(C)(C)C(=O)C(=C(O)c1ncnc2ccccc12)C(F)(F)F.
What is the InChIKey of 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one?
The InChIKey is MGUNUMYBYLRRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N2O2/c1-15(2,3)14(23)11(16(17,18)19)13(22)12-9-6-4-5-7-10(9)20-8-21-12/h4-8,22H,1-3H3.
What are the key properties of 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one?
1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one has a molecular weight of 324.30 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4,4-dimethyl-1-quinazolin-4-yl-2-(trifluoromethyl)pent-1-en-3-one is sourced from PubChem (CID 147353970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).