C20H19ClFN5O4S2 — CID 147379346
5-N-(1,3-benzothiazol-2-ylmethyl)-3-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide (PubChem CID 147379346) has the molecular formula C20H19ClFN5O4S2 and a molecular weight of 511.99 g/mol. Its IUPAC name is 5-N-(1,3-benzothiazol-2-ylmethyl)-3-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide.
| Compound Name | 5-N-(1,3-benzothiazol-2-ylmethyl)-3-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
|---|---|
| PubChem CID | 147379346 |
| Molecular Formula | C20H19ClFN5O4S2 |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 5-N-(1,3-benzothiazol-2-ylmethyl)-3-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
| SMILES | CN1C(C(=O)Nc2ccc(F)c(Cl)c2)CC(C(=O)NCc2nc3ccccc3s2)NS1(=O)=O |
| InChI | InChI=1S/C20H19ClFN5O4S2/c1-27-16(20(29)24-11-6-7-13(22)12(21)8-11)9-15(26-33(27,30)31)19(28)23-10-18-25-14-4-2-3-5-17(14)32-18/h2-8,15-16,26H,9-10H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | DKQUHBORFAREIA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |