C29H27ClFN5O4S2 — CID 167380634
3-N-(3-chloro-4-fluorophenyl)-2-methyl-5-N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)-phenylmethyl]-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide (PubChem CID 167380634) has the molecular formula C29H27ClFN5O4S2 and a molecular weight of 628.15 g/mol. Its IUPAC name is 3-N-(3-chloro-4-fluorophenyl)-2-methyl-5-N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)-phenylmethyl]-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide.
| Compound Name | 3-N-(3-chloro-4-fluorophenyl)-2-methyl-5-N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)-phenylmethyl]-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
|---|---|
| PubChem CID | 167380634 |
| Molecular Formula | C29H27ClFN5O4S2 |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | 3-N-(3-chloro-4-fluorophenyl)-2-methyl-5-N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)-phenylmethyl]-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(NC(=O)C1CC(C(=O)Nc2ccc(F)c(Cl)c2)N(C)S(=O)(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C29H27ClFN5O4S2/c1-17-26(41-29(32-17)19-11-7-4-8-12-19)25(18-9-5-3-6-10-18)34-27(37)23-16-24(36(2)42(39,40)35-23)28(38)33-20-13-14-22(31)21(30)15-20/h3-15,23-25,35H,16H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | OMRSBEZFMPKPSP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |