C16H15N3O3 — CID 14743340
ethyl 6-methoxy-2-phenylimidazo[1,2-b]pyridazine-3-carboxylate (PubChem CID 14743340) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 6-methoxy-2-phenylimidazo[1,2-b]pyridazine-3-carboxylate.
| Compound Name | ethyl 6-methoxy-2-phenylimidazo[1,2-b]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 14743340 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 6-methoxy-2-phenylimidazo[1,2-b]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc2ccc(OC)nn12 |
| InChI | InChI=1S/C16H15N3O3/c1-3-22-16(20)15-14(11-7-5-4-6-8-11)17-12-9-10-13(21-2)18-19(12)15/h4-10H,3H2,1-2H3 |
| InChIKey | YUDGTMYOTCPTJW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |