About [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone
[iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone (PubChem CID 147456598) has the molecular formula C6H11I2NO2
and a molecular weight of 382.97 g/mol. Its IUPAC name is [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone |
| PubChem CID | 147456598 |
| Molecular Formula | C6H11I2NO2 |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 382.89 |
| IUPAC Name | [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone |
| SMILES | CI(I)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C6H11I2NO2/c1-8(7)6(10)9-2-4-11-5-3-9/h2-5H2,1H3 |
| InChIKey | DZCKFKMDEJDLLP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone?
The IUPAC name of [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone (CID 147456598) is [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone?
The canonical SMILES for [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone is CI(I)C(=O)N1CCOCC1.
What is the InChIKey of [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone?
The InChIKey is DZCKFKMDEJDLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11I2NO2/c1-8(7)6(10)9-2-4-11-5-3-9/h2-5H2,1H3.
What are the key properties of [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone?
[iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone has a molecular weight of 382.97 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [iodo(methyl)-λ3-iodanyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 147456598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).