C32H45N5O6 — CID 147486336
methyl (2S)-2-[[(3S)-1-[(3E,5S,8R)-5-(1H-indol-3-ylmethyl)-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-4-methyl-2-oxopentan-3-yl]carbamoylamino]-3-methylbutanoate (PubChem CID 147486336) has the molecular formula C32H45N5O6 and a molecular weight of 595.74 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S)-1-[(3E,5S,8R)-5-(1H-indol-3-ylmethyl)-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-4-methyl-2-oxopentan-3-yl]carbamoylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(3S)-1-[(3E,5S,8R)-5-(1H-indol-3-ylmethyl)-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-4-methyl-2-oxopentan-3-yl]carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 147486336 |
| Molecular Formula | C32H45N5O6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | methyl (2S)-2-[[(3S)-1-[(3E,5S,8R)-5-(1H-indol-3-ylmethyl)-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]-4-methyl-2-oxopentan-3-yl]carbamoylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N[C@H](C(=O)C[C@H]1CCCCNC(=O)/C=C/[C@H](Cc2c[nH]c3ccccc23)NC1=O)C(C)C)C(C)C |
| InChI | InChI=1S/C32H45N5O6/c1-19(2)28(36-32(42)37-29(20(3)4)31(41)43-5)26(38)17-21-10-8-9-15-33-27(39)14-13-23(35-30(21)40)16-22-18-34-25-12-7-6-11-24(22)25/h6-7,11-14,18-21,23,28-29,34H,8-10,15-17H2,1-5H3,(H,33,39)(H,35,40)(H2,36,37,42)/b14-13+/t21-,23-,28+,29+/m1/s1 |
| InChIKey | FEQNTXGFXGGJAB-VORXAJJNSA-N |
| XLogP | 3.15 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |