C22H19N5O3 — CID 147486998
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1H-indol-3-yl)imidazole-4-carboxamide (PubChem CID 147486998) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1H-indol-3-yl)imidazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1H-indol-3-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 147486998 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1H-indol-3-yl)imidazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cncn1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19N5O3/c23-21(29)20(28)17(10-14-6-2-1-3-7-14)26-22(30)19-11-24-13-27(19)18-12-25-16-9-5-4-8-15(16)18/h1-9,11-13,17,25H,10H2,(H2,23,29)(H,26,30) |
| InChIKey | FETUJCJMDQCUCN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|