C21H21N3O3 — CID 147531250
1-(2,5-dimethoxyphenyl)-5-imino-4-(7-methyl-1,3-dihydroindol-2-ylidene)pyrrolidin-3-one (PubChem CID 147531250) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-imino-4-(7-methyl-1,3-dihydroindol-2-ylidene)pyrrolidin-3-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-imino-4-(7-methyl-1,3-dihydroindol-2-ylidene)pyrrolidin-3-one |
|---|---|
| PubChem CID | 147531250 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-imino-4-(7-methyl-1,3-dihydroindol-2-ylidene)pyrrolidin-3-one |
| SMILES | [H]/N=C1\C(=C2Cc3cccc(C)c3N2)C(=O)CN1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H21N3O3/c1-12-5-4-6-13-9-15(23-20(12)13)19-17(25)11-24(21(19)22)16-10-14(26-2)7-8-18(16)27-3/h4-8,10,22-23H,9,11H2,1-3H3/b19-15?,22-21+ |
| InChIKey | OBLCBYAYXRITHY-ZKOWVJSDSA-N |
| XLogP | 3.30 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|