C26H23N3O3 — CID 158293409
(2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-phenylpyrrolidin-3-one (PubChem CID 158293409) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-phenylpyrrolidin-3-one.
| Compound Name | (2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-phenylpyrrolidin-3-one |
|---|---|
| PubChem CID | 158293409 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-phenylpyrrolidin-3-one |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)[C@@H](c2ccccc2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H23N3O3/c1-31-19-13-18(14-20(15-19)32-2)29-24(16-8-4-3-5-9-16)25(30)23(26(29)27)22-12-17-10-6-7-11-21(17)28-22/h3-11,13-15,24,27-28H,12H2,1-2H3/b23-22?,27-26-/t24-/m1/s1 |
| InChIKey | YKTGIDSBFZQWDZ-BEVGWEBHSA-N |
| XLogP | 4.73 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|