C24H27N3O3 — CID 152802022
(2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-ethyliminopyrrolidin-3-one (PubChem CID 152802022) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-ethyliminopyrrolidin-3-one.
| Compound Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-ethyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 152802022 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-ethyliminopyrrolidin-3-one |
| SMILES | CC/N=C1/C(=C2Cc3ccccc3N2)C(=O)[C@H](CC)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-5-21-23(28)22(20-11-15-9-7-8-10-19(15)26-20)24(25-6-2)27(21)16-12-17(29-3)14-18(13-16)30-4/h7-10,12-14,21,26H,5-6,11H2,1-4H3/b22-20?,25-24-/t21-/m0/s1 |
| InChIKey | ZLJYNIVZGLSHCV-JHFKKWFUSA-N |
| XLogP | 4.21 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|