C24H27N3O4 — CID 157435962
(2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(methoxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one (PubChem CID 157435962) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(methoxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one.
| Compound Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(methoxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 157435962 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(methoxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one |
| SMILES | C/N=C1/C(=C2Cc3ccccc3N2)C(=O)[C@](C)(COC)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-24(14-29-3)22(28)21(20-10-15-8-6-7-9-19(15)26-20)23(25-2)27(24)16-11-17(30-4)13-18(12-16)31-5/h6-9,11-13,26H,10,14H2,1-5H3/b21-20?,25-23-/t24-/m0/s1 |
| InChIKey | XOLURZRSJBXFJX-RLKCBEKYSA-N |
| XLogP | 3.45 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|