C23H25N3O4 — CID 159322022
(2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one (PubChem CID 159322022) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one.
| Compound Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 159322022 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (2S)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2-methyl-5-methyliminopyrrolidin-3-one |
| SMILES | C/N=C1/C(=C2Cc3ccccc3N2)C(=O)[C@](C)(CO)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-23(13-27)21(28)20(19-9-14-7-5-6-8-18(14)25-19)22(24-2)26(23)15-10-16(29-3)12-17(11-15)30-4/h5-8,10-12,25,27H,9,13H2,1-4H3/b20-19?,24-22-/t23-/m0/s1 |
| InChIKey | QUHDRSLGGBGHPX-FKXBIIALSA-N |
| XLogP | 2.79 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|