C17H23O7P — CID 14754694
(3aS,5S,6S,6aS)-6-methoxy-5-[2-[methoxy(phenyl)phosphoryl]oxiran-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 14754694) has the molecular formula C17H23O7P and a molecular weight of 370.34 g/mol. Its IUPAC name is (3aS,5S,6S,6aS)-6-methoxy-5-[2-[methoxy(phenyl)phosphoryl]oxiran-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aS,5S,6S,6aS)-6-methoxy-5-[2-[methoxy(phenyl)phosphoryl]oxiran-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 14754694 |
| Molecular Formula | C17H23O7P |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (3aS,5S,6S,6aS)-6-methoxy-5-[2-[methoxy(phenyl)phosphoryl]oxiran-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2O[C@@H]1C1(P(=O)(OC)c2ccccc2)CO1 |
| InChI | InChI=1S/C17H23O7P/c1-16(2)23-13-12(19-3)14(22-15(13)24-16)17(10-21-17)25(18,20-4)11-8-6-5-7-9-11/h5-9,12-15H,10H2,1-4H3/t12-,13-,14-,15-,17?,25?/m0/s1 |
| InChIKey | PETMCJXJLKXHLZ-WNTHOXPISA-N |
| XLogP | 1.85 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|