C18H25O8P — CID 4868241
5-(2-dimethoxyphosphoryloxiran-2-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 4868241) has the molecular formula C18H25O8P and a molecular weight of 400.36 g/mol. Its IUPAC name is 5-(2-dimethoxyphosphoryloxiran-2-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | 5-(2-dimethoxyphosphoryloxiran-2-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 4868241 |
| Molecular Formula | C18H25O8P |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 5-(2-dimethoxyphosphoryloxiran-2-yl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COP(=O)(OC)C1(C2OC3OC(C)(C)OC3C2OCc2ccccc2)CO1 |
| InChI | InChI=1S/C18H25O8P/c1-17(2)25-14-13(22-10-12-8-6-5-7-9-12)15(24-16(14)26-17)18(11-23-18)27(19,20-3)21-4/h5-9,13-16H,10-11H2,1-4H3 |
| InChIKey | YLMHOODOAZKQDW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|