C14H11N3O2S — CID 147549277
2-(1H-indole-2-carbonyl)-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 147549277) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-(1H-indole-2-carbonyl)-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1H-indole-2-carbonyl)-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 147549277 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(1H-indole-2-carbonyl)-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(C(=O)c2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C14H11N3O2S/c1-15-13(19)11-7-20-14(17-11)12(18)10-6-8-4-2-3-5-9(8)16-10/h2-7,16H,1H3,(H,15,19) |
| InChIKey | FQLJUYIWNYQUES-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |