C9H13N2+ — CID 147553850
1-(6-iminocyclohexa-2,4-dien-1-ylidene)ethyl-methylazanium (PubChem CID 147553850) has the molecular formula C9H13N2+ and a molecular weight of 149.22 g/mol. Its IUPAC name is 1-(6-iminocyclohexa-2,4-dien-1-ylidene)ethyl-methylazanium.
| Compound Name | 1-(6-iminocyclohexa-2,4-dien-1-ylidene)ethyl-methylazanium |
|---|---|
| PubChem CID | 147553850 |
| Molecular Formula | C9H13N2+ |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 1-(6-iminocyclohexa-2,4-dien-1-ylidene)ethyl-methylazanium |
| SMILES | [H]/N=C1\C=CC=CC1=C(C)[NH2+]C |
| InChI | InChI=1S/C9H12N2/c1-7(11-2)8-5-3-4-6-9(8)10/h3-6,10-11H,1-2H3/p+1/b8-7?,10-9+ |
| InChIKey | FRHKMUFEIINJMX-IPBYNONMSA-O |
| XLogP | 0.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|