C21H23FN2O5 — CID 147555968
6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1-(2-fluoroethyl)-5-methyl-3-propylquinazoline-2,4-dione (PubChem CID 147555968) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1-(2-fluoroethyl)-5-methyl-3-propylquinazoline-2,4-dione.
| Compound Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1-(2-fluoroethyl)-5-methyl-3-propylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 147555968 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1-(2-fluoroethyl)-5-methyl-3-propylquinazoline-2,4-dione |
| SMILES | CCCn1c(=O)c2c(C)c(C(O)=C3C(=O)CCCC3=O)ccc2n(CCF)c1=O |
| InChI | InChI=1S/C21H23FN2O5/c1-3-10-24-20(28)17-12(2)13(7-8-14(17)23(11-9-22)21(24)29)19(27)18-15(25)5-4-6-16(18)26/h7-8,27H,3-6,9-11H2,1-2H3 |
| InChIKey | SXMYUTLHOGIOPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|