C19H29NO2 — CID 147565216
(3S,8S,13S,14R)-8-amino-3-hydroxy-10,13-dimethyl-2,3,4,7,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 147565216) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (3S,8S,13S,14R)-8-amino-3-hydroxy-10,13-dimethyl-2,3,4,7,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8S,13S,14R)-8-amino-3-hydroxy-10,13-dimethyl-2,3,4,7,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 147565216 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (3S,8S,13S,14R)-8-amino-3-hydroxy-10,13-dimethyl-2,3,4,7,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CC[C@H](O)CC1=CC[C@]1(N)C2CC[C@]2(C)C(=O)CC[C@H]21 |
| InChI | InChI=1S/C19H29NO2/c1-17-8-6-13(21)11-12(17)5-10-19(20)14-3-4-16(22)18(14,2)9-7-15(17)19/h5,13-15,21H,3-4,6-11,20H2,1-2H3/t13-,14+,15?,17?,18-,19+/m0/s1 |
| InChIKey | FTKVHDOFANBCCE-DRLBXOBISA-N |
| XLogP | 2.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|