C14H16O2 — CID 14756710
(1S,3S,4R)-3-[(1R,2R,4R)-2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl]bicyclo[2.2.1]hept-5-en-2-one (PubChem CID 14756710) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S,3S,4R)-3-[(1R,2R,4R)-2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl]bicyclo[2.2.1]hept-5-en-2-one.
| Compound Name | (1S,3S,4R)-3-[(1R,2R,4R)-2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl]bicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| PubChem CID | 14756710 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1S,3S,4R)-3-[(1R,2R,4R)-2-hydroxy-2-bicyclo[2.2.1]hept-5-enyl]bicyclo[2.2.1]hept-5-en-2-one |
| SMILES | O=C1[C@@H]2C=C[C@@H](C2)[C@H]1[C@@]1(O)C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H16O2/c15-13-10-3-2-9(6-10)12(13)14(16)7-8-1-4-11(14)5-8/h1-4,8-12,16H,5-7H2/t8-,9+,10-,11+,12-,14-/m1/s1 |
| InChIKey | KRJLSROHJJOJAS-PWBIQZBHSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|