C8H9NO3SWY-2 — CID 147571637
1-[2-methyl-2,3-bis(oxomethyl)-1,3-thiazolidin-4-yl]ethanone;tungsten;yttrium (PubChem CID 147571637) has the molecular formula C8H9NO3SWY-2 and a molecular weight of 471.98 g/mol. Its IUPAC name is 1-[2-methyl-2,3-bis(oxomethyl)-1,3-thiazolidin-4-yl]ethanone;tungsten;yttrium.
| Compound Name | 1-[2-methyl-2,3-bis(oxomethyl)-1,3-thiazolidin-4-yl]ethanone;tungsten;yttrium |
|---|---|
| PubChem CID | 147571637 |
| Molecular Formula | C8H9NO3SWY-2 |
| Molecular Weight | 471.98 g/mol |
| Exact Mass | 471.89 |
| IUPAC Name | 1-[2-methyl-2,3-bis(oxomethyl)-1,3-thiazolidin-4-yl]ethanone;tungsten;yttrium |
| SMILES | CC(=O)C1CSC(C)([C-]=O)N1[C-]=O.[W].[Y] |
| InChI | InChI=1S/C8H9NO3S.W.Y/c1-6(12)7-3-13-8(2,4-10)9(7)5-11;;/h7H,3H2,1-2H3;;/q-2;; |
| InChIKey | YUYHWFHGUFZDED-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.98 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|