C16H13BI2O5- — CID 147596452
CID 147596452 (PubChem CID 147596452) has the molecular formula C16H13BI2O5- and a molecular weight of 549.90 g/mol.
| Compound Name | CID 147596452 |
|---|---|
| PubChem CID | 147596452 |
| Molecular Formula | C16H13BI2O5- |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 549.90 |
| IUPAC Name | — |
| SMILES | CC(I)(C(=O)OCC(=O)Oc1ccc2cc(O)ccc2c1)C1[B][I-]1 |
| InChI | InChI=1S/C16H13BI2O5/c1-16(18,14-17-19-14)15(22)23-8-13(21)24-12-5-3-9-6-11(20)4-2-10(9)7-12/h2-7,14,20H,8H2,1H3/q-1 |
| InChIKey | VFNQOGQGJXAUSC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|