C13H20INO — CID 147597666
cis-(1S,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexan-1-amine (PubChem CID 147597666) has the molecular formula C13H20INO and a molecular weight of 333.21 g/mol. Its IUPAC name is cis-(1S,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexan-1-amine.
| Compound Name | cis-(1S,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 147597666 |
| Molecular Formula | C13H20INO |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | cis-(1S,2R)-2-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)ethoxy]cyclohexan-1-amine |
| SMILES | N[C@H]1CCCC[C@H]1OCCC1=CC=IC=C1 |
| InChI | InChI=1S/C13H20INO/c15-12-3-1-2-4-13(12)16-10-7-11-5-8-14-9-6-11/h5-6,8-9,12-13H,1-4,7,10,15H2/t12-,13+/m0/s1 |
| InChIKey | FZMWYMLEHJHATG-QWHCGFSZSA-N |
| XLogP | 2.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|