C11H22N2 — CID 147627142
(3E,5E)-4-N-ethylnona-3,5-diene-4,5-diamine (PubChem CID 147627142) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (3E,5E)-4-N-ethylnona-3,5-diene-4,5-diamine.
| Compound Name | (3E,5E)-4-N-ethylnona-3,5-diene-4,5-diamine |
|---|---|
| PubChem CID | 147627142 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (3E,5E)-4-N-ethylnona-3,5-diene-4,5-diamine |
| SMILES | CC/C=C(NCC)\C(N)=C/CCC |
| InChI | InChI=1S/C11H22N2/c1-4-7-9-10(12)11(8-5-2)13-6-3/h8-9,13H,4-7,12H2,1-3H3/b10-9+,11-8+ |
| InChIKey | GEZWRDRYTSXWNQ-RUFFMTGISA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|