C18H15ClN2OS2 — CID 1476296
2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-phenylsulfanylpyrimidine (PubChem CID 1476296) has the molecular formula C18H15ClN2OS2 and a molecular weight of 374.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-phenylsulfanylpyrimidine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-phenylsulfanylpyrimidine |
|---|---|
| PubChem CID | 1476296 |
| Molecular Formula | C18H15ClN2OS2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-phenylsulfanylpyrimidine |
| SMILES | COc1cnc(SCc2ccc(Cl)cc2)nc1Sc1ccccc1 |
| InChI | InChI=1S/C18H15ClN2OS2/c1-22-16-11-20-18(23-12-13-7-9-14(19)10-8-13)21-17(16)24-15-5-3-2-4-6-15/h2-11H,12H2,1H3 |
| InChIKey | UINMMRDETTZBOD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |