C19H14ClF3N2O2S — CID 1476297
2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-[3-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 1476297) has the molecular formula C19H14ClF3N2O2S and a molecular weight of 426.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-[3-(trifluoromethyl)phenoxy]pyrimidine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-[3-(trifluoromethyl)phenoxy]pyrimidine |
|---|---|
| PubChem CID | 1476297 |
| Molecular Formula | C19H14ClF3N2O2S |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-methoxy-4-[3-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | COc1cnc(SCc2ccc(Cl)cc2)nc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14ClF3N2O2S/c1-26-16-10-24-18(28-11-12-5-7-14(20)8-6-12)25-17(16)27-15-4-2-3-13(9-15)19(21,22)23/h2-10H,11H2,1H3 |
| InChIKey | ZGBFZXZYCUSBMF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |