C18H9Cl2F5N2OS2 — CID 5169125
2-[(3,4-dichlorophenyl)methylsulfanyl]-5-methoxy-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrimidine (PubChem CID 5169125) has the molecular formula C18H9Cl2F5N2OS2 and a molecular weight of 499.31 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-methoxy-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrimidine.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-methoxy-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrimidine |
|---|---|
| PubChem CID | 5169125 |
| Molecular Formula | C18H9Cl2F5N2OS2 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 497.95 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-methoxy-4-(2,3,4,5,6-pentafluorophenyl)sulfanylpyrimidine |
| SMILES | COc1cnc(SCc2ccc(Cl)c(Cl)c2)nc1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H9Cl2F5N2OS2/c1-28-10-5-26-18(29-6-7-2-3-8(19)9(20)4-7)27-17(10)30-16-14(24)12(22)11(21)13(23)15(16)25/h2-5H,6H2,1H3 |
| InChIKey | OUVHUHMLOGAFFV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|